CAS 636-69-1
:2-Hydroxyheptanoic acid
Description:
2-Hydroxyheptanoic acid, also known as 2-hydroxy-7-heptanoic acid, is a carboxylic acid characterized by the presence of a hydroxyl group (-OH) attached to the second carbon of a seven-carbon chain. Its molecular formula is C7H14O3, and it features both hydrophilic and hydrophobic properties due to its functional groups, making it amphiphilic. This compound typically appears as a colorless to pale yellow liquid and is soluble in water, which is attributed to the hydroxyl group. It has applications in various fields, including pharmaceuticals and food chemistry, where it may serve as an intermediate in the synthesis of other compounds or as a flavoring agent. The presence of the hydroxyl group also allows for potential reactivity in esterification and other organic reactions. Safety data indicates that, like many organic acids, it should be handled with care, as it may cause irritation to skin and eyes. Overall, 2-hydroxyheptanoic acid is a versatile compound with significant chemical properties and potential applications.
Formula:C7H14O3
InChI:InChI=1S/C7H14O3/c1-2-3-4-5-6(8)7(9)10/h6,8H,2-5H2,1H3,(H,9,10)
InChI key:InChIKey=RGMMREBHCYXQMA-UHFFFAOYSA-N
SMILES:C(CCCCC)(C(O)=O)O
Synonyms:- Heptanoic acid, 2-hydroxy-
- 2-Hydroxyheptanoic acid
- α-Hydroxyenanthic acid
- 2-Hydroxyenanthylic acid
- α-Hydroxyheptanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Hydroxyheptanoic acid
CAS:2-Hydroxyheptanoic acid is a metabolite of 2,6-dihydroxypyridine (DHP), which is an organic compound that can be found in the environment and produced by microbes. 2-Hydroxyheptanoic acid has been shown to inhibit the function of the ryanodine receptor in rat cardiac cells, which may cause arrhythmia. The drug also inhibits fatty acid synthesis and hydrolysis in the small intestine. It is synthesized from oleic acid through demethylation or hydroxylation. The technique used to produce this drug is not known. Verticillium produces this metabolite as a result of its metabolism of DHP.END>Formula:C7H14O3Purity:Min. 95%Molecular weight:146.18 g/mol


