CAS 63604-86-4
:(3-acetyl-2,6-dimethoxy-phenyl) acetate
Description:
(3-acetyl-2,6-dimethoxy-phenyl) acetate, with the CAS number 63604-86-4, is an organic compound characterized by its aromatic structure and the presence of multiple functional groups. It features an acetyl group and two methoxy groups attached to a phenyl ring, which contribute to its chemical reactivity and potential applications. The methoxy groups enhance the compound's solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including substitution and acylation. The acetyl group can participate in further reactions, such as hydrolysis or condensation, depending on the conditions. This compound may exhibit biological activity, which is often explored in medicinal chemistry, particularly in the development of pharmaceuticals. Its structural features suggest potential uses in organic synthesis, as well as in the formulation of fragrances or flavoring agents due to its aromatic nature. Overall, (3-acetyl-2,6-dimethoxy-phenyl) acetate is a versatile compound with interesting chemical properties and potential applications in various fields.
Formula:C12H14O5
InChI:InChI=1/C12H14O5/c1-7(13)9-5-6-10(15-3)12(11(9)16-4)17-8(2)14/h5-6H,1-4H3
SMILES:CC(=O)c1ccc(c(c1OC)OC(=O)C)OC
Synonyms:- 3-Acetyl-2,6-dimethoxyphenyl acetate
- Ethanone, 1-[3-(Acetyloxy)-2,4-Dimethoxyphenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-Acetoxy-2,4-dimethoxyacetophenone
CAS:<p>3-Acetoxy-2,4-dimethoxyacetophenone is a chemical building block that has been shown to be useful in the synthesis of complex compounds. This compound can be used as a reaction component and reagent in organic synthesis. 3-Acetoxy-2,4-dimethoxyacetophenone can be used as a versatile building block for the synthesis of high quality research chemicals and speciality chemicals. It is also a useful intermediate for the preparation of fine chemicals such as pharmaceuticals, agrochemicals, and dyestuffs. 3-Acetoxy-2,4-dimethoxyacetophenone has CAS number 63604-86-4.</p>Formula:C12H14O5Purity:Min. 95%Molecular weight:238.24 g/mol
