CAS 63608-33-3

4-[(4-chlorophenoxy)methyl]piperidine

Description:

4-[(4-Chlorophenoxy)methyl]piperidine, with the CAS number 63608-33-3, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a chlorophenoxy group, where a chlorine atom is substituted on a phenyl ring that is ether-linked to a methyl group attached to the piperidine. The presence of the chlorophenyl moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential interactions with biological targets, which could be explored for pharmacological applications. Additionally, the presence of the piperidine ring may influence its basicity and reactivity, making it a candidate for further chemical modifications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₆ClNO

InChI: InChI=1/C12H16ClNO/c13-11-1-3-12(4-2-11)15-9-10-5-7-14-8-6-10/h1-4,10,14H,5-9H2

SMILES: c1cc(ccc1Cl)OCC1CCNCC1

Synonyms:

• Piperidine, 4-[(4-Chlorophenoxy)Methyl]-

4-[(4-Chlorophenoxy)methyl]piperidine

Controlled Product

CAS: 63608-33-3

Formula: C₁₂H₁₆ClNO

Color and Shape: Neat

Molecular weight: 225.714

Ref: TR-C375065