CAS 6361-29-1
:4-Amino-N-ethyl-N-1-naphthalenylbenzamide
Description:
4-Amino-N-ethyl-N-1-naphthalenylbenzamide, with the CAS number 6361-29-1, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This compound features a naphthalene ring, which contributes to its aromatic properties, and an ethyl substituent on the nitrogen atom, enhancing its lipophilicity. The presence of the amino group indicates potential basicity and reactivity, making it suitable for various chemical reactions, including coupling reactions in organic synthesis. Its structure suggests that it may exhibit biological activity, potentially serving as a pharmaceutical intermediate or a research chemical. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Amino-N-ethyl-N-1-naphthalenylbenzamide is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C19H18N2O
InChI:InChI=1S/C19H18N2O/c1-2-21(19(22)15-10-12-16(20)13-11-15)18-9-5-7-14-6-3-4-8-17(14)18/h3-13H,2,20H2,1H3
InChI key:InChIKey=PZIJKAARIDUWEZ-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=C(N)C=C1)(CC)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- 4-Amino-N-ethyl-N-1-naphthalenylbenzamide
- 4-amino-N-ethyl-N-(naphthalen-1-yl)benzamide
- Benzamide, 4-amino-N-ethyl-N-1-naphthalenyl-
- Benzamide, p-amino-N-ethyl-N-1-naphthyl-
- p-Amino-N-ethyl-N-1-naphthylbenzamide
- 4-Amino-N-ethyl-N-1-naphthylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.