
CAS 6361-95-1
:4-Methyl-N-[(phenylamino)thioxomethyl]benzenesulfonamide
Description:
4-Methyl-N-[(phenylamino)thioxomethyl]benzenesulfonamide, with the CAS number 6361-95-1, is a chemical compound that belongs to the class of sulfonamides, which are characterized by the presence of a sulfonamide functional group (-SO2NH2). This compound features a methyl group and a thioxomethyl group attached to a phenylamino moiety, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide group. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its structure suggests that it could interact with biological targets, possibly influencing enzymatic pathways or receptor interactions. As with many sulfonamides, it may also exhibit antibacterial properties. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies and safety assessments.
Formula:C14H14N2O2S2
InChI:InChI=1S/C14H14N2O2S2/c1-11-7-9-13(10-8-11)20(17,18)16-14(19)15-12-5-3-2-4-6-12/h2-10H,1H3,(H2,15,16,19)
InChI key:InChIKey=YRWXBKFHKPTRKR-UHFFFAOYSA-N
SMILES:S(NC(NC1=CC=CC=C1)=S)(=O)(=O)C2=CC=C(C)C=C2
Synonyms:- 1-(4-Methylphenyl)sulfonyl-3-phenylthiourea
- NSC 104843
- Benzenesulfonamide, 4-methyl-N-[(phenylamino)thioxomethyl]-
- 4-Methyl-N-[(phenylamino)thioxomethyl]benzenesulfonamide
- Urea, 1-phenyl-2-thio-3-(p-tolylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.