CAS 6362-80-7
:2,4-Diphenyl-4-methyl-1-pentene
Description:
2,4-Diphenyl-4-methyl-1-pentene is an organic compound characterized by its unique structure, which includes a pentene backbone with two phenyl groups and a methyl group attached to the fourth carbon. This compound is classified as an alkene due to the presence of a carbon-carbon double bond, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple aromatic rings (phenyl groups) enhances its stability and can influence its physical properties, such as solubility and boiling point. Typically, compounds like 2,4-Diphenyl-4-methyl-1-pentene exhibit hydrophobic characteristics, making them less soluble in water but more soluble in organic solvents. Additionally, the compound may participate in various chemical reactions, including polymerization and electrophilic addition, due to the double bond. Its specific applications can vary, but it may be utilized in the synthesis of more complex organic molecules or as an intermediate in chemical manufacturing. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C18H20
InChI:InChI=1S/C18H20/c1-15(16-10-6-4-7-11-16)14-18(2,3)17-12-8-5-9-13-17/h4-13H,1,14H2,2-3H3
InChI key:InChIKey=ZOKCNEIWFQCSCM-UHFFFAOYSA-N
SMILES:C(CC(=C)C1=CC=CC=C1)(C)(C)C2=CC=CC=C2
Synonyms:- (2-Methyl-4-phenylpent-4-en-2-yl)benzene
- 1,1'-(1,1-Dimethyl-3-methylene-1,3-propanediyl)bisbenzene
- 1,1'-(4-Methylpent-1-Ene-2,4-Diyl)Dibenzene
- 1,1′-(1,1-Dimethyl-3-methylene-1,3-propanediyl)bis[benzene]
- 1-Pentene, 4-methyl-2,4-diphenyl-
- 4,4-Dimethyl-2,4-diphenyl-1-butene
- 4-Methyl-2,4-diphenyl-1-pentene
- Alpha Methyl Styrene Dimer
- Benzene, 1,1'-(1,1-dimethyl-3-methylene-1,3-propanediyl)bis-
- Dk 80
- Dk 81
- Dk 86
- Nofmer MSD
- α-(2-Methyl-2-phenylpropyl)styrene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,4-Diphenyl-4-methyl-1-pentene
CAS:Formula:C18H20Purity:>95.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:236.36(4-Methylpent-1-ene-2,4-diyl)dibenzene
CAS:Formula:C18H20Purity:98%Color and Shape:LiquidMolecular weight:236.35142,4-Diphenyl-4-Methyl-1-Pentene
CAS:2,4-Diphenyl-4-Methyl-1-PentenePurity:85%Molecular weight:236.35g/molNofmer MSD
CAS:Applications Nofmer MSD is chain transfer agent; is used in preparation of Polyvinyl Acetate.
References Zheng, Q., et al.: Faming Zhuanli Shenqing, (2019);Formula:C18H20Color and Shape:NeatMolecular weight:236.35(4-Methylpent-1-ene-2,4-diyl)dibenzene
CAS:Formula:C18H20Purity:98% (mixture, contains ~6% β-olefin)Color and Shape:LiquidMolecular weight:236.3582,4-Diphenyl-4-methyl-1-pentene
CAS:2,4-Diphenyl-4-methyl-1-pentene is a chemical substance that has been used as an analog for the compound 2,4-dinitrophenylhydrazine. It can be used to crosslink proteins and other biological molecules by reaction with hydroxyl groups. The transfer mechanism of this substance is based on the formation of covalent bonds between two adjacent molecules. This process creates particle chains that are then immobilized in a polymeric matrix or in the surface of a porous material. The optical properties of 2,4-DMPP depend on the density and size of these particles. The dry weight and optical properties can be determined using an analytical method such as infrared spectroscopy or polarized light microscopy. 2,4-DMPP has been found to have health effects such as hydroxy group accumulation in tissues and adverse reproductive effects in animals when administered at high doses.Formula:C18H20Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:236.36 g/mol





