CAS 6362-80-7: 2,4-Diphenyl-4-methyl-1-pentene
Description:2,4-Diphenyl-4-methyl-1-pentene is an organic compound characterized by its unique structure, which includes a pentene backbone with two phenyl groups and a methyl group attached to the fourth carbon. This compound is classified as an alkene due to the presence of a carbon-carbon double bond, which contributes to its reactivity and potential applications in organic synthesis. The presence of multiple aromatic rings (phenyl groups) enhances its stability and can influence its physical properties, such as solubility and boiling point. Typically, compounds like 2,4-Diphenyl-4-methyl-1-pentene exhibit hydrophobic characteristics, making them less soluble in water but more soluble in organic solvents. Additionally, the compound may participate in various chemical reactions, including polymerization and electrophilic addition, due to the double bond. Its specific applications can vary, but it may be utilized in the synthesis of more complex organic molecules or as an intermediate in chemical manufacturing. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C18H20
InChI:InChI=1S/C18H20/c1-15(16-10-6-4-7-11-16)14-18(2,3)17-12-8-5-9-13-17/h4-13H,1,14H2,2-3H3
InChI key:InChIKey=ZOKCNEIWFQCSCM-UHFFFAOYSA-N
SMILES:C=C(C=1C=CC=CC1)CC(C=2C=CC=CC2)(C)C
- Synonyms:
- (2-Methyl-4-phenylpent-4-en-2-yl)benzene
- 1,1'-(1,1-Dimethyl-3-methylene-1,3-propanediyl)bisbenzene
- 1,1'-(4-Methylpent-1-Ene-2,4-Diyl)Dibenzene
- 1,1′-(1,1-Dimethyl-3-methylene-1,3-propanediyl)bis[benzene]
- 1-Pentene, 4-methyl-2,4-diphenyl-
- 4,4-Dimethyl-2,4-diphenyl-1-butene
- 4-Methyl-2,4-diphenyl-1-pentene
- Alpha Methyl Styrene Dimer
- Benzene, 1,1'-(1,1-dimethyl-3-methylene-1,3-propanediyl)bis-
- Dk 80
- See more synonyms
- Dk 81
- Dk 86
- Nofmer MSD
- α-(2-Methyl-2-phenylpropyl)styrene
- 2,4-Diphenyl-4-methyl-1-pentene
