CAS 63631-41-4

Phenol, 4-(3,4-dihydro-7-methoxy-2H-1-benzopyran-3-yl)-3-methoxy-

Description:

Phenol, 4-(3,4-dihydro-7-methoxy-2H-1-benzopyran-3-yl)-3-methoxy- is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This specific compound features a methoxy group (-OCH3) at both the 3 and 4 positions of the phenolic ring, enhancing its solubility and reactivity. The presence of the 3,4-dihydro-7-methoxy-2H-1-benzopyran moiety indicates that it possesses a fused ring system, contributing to its potential biological activity. Such compounds often exhibit antioxidant properties and may interact with various biological targets, making them of interest in medicinal chemistry. The molecular structure suggests that it could participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties such as melting point and solubility. Overall, this compound's unique structural features may provide insights into its applications in pharmaceuticals or as a chemical intermediate in organic synthesis.

Formula: C₁₇H₁₈O₄

InChI: InChI=1S/C17H18O4/c1-19-14-5-3-11-7-12(10-21-16(11)9-14)15-6-4-13(18)8-17(15)20-2/h3-6,8-9,12,18H,7,10H2,1-2H3

InChI key: InChIKey=RQPCHUUIUGRXGY-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(O)=C1)C2CC=3C(OC2)=CC(OC)=CC3

Synonyms:

• Arvensan
• Phenol, 4-(3,4-dihydro-7-methoxy-2H-1-benzopyran-3-yl)-3-methoxy-

Arvensan

CAS: 63631-41-4

Arvensan is a bioactive compound that acts as a biocide, derived from natural sources such as certain plant species. Its primary mode of action involves disrupting the cellular membranes of target microorganisms, leading to cell lysis and eventual death. This mechanism ensures efficacy against a broad spectrum of bacteria and fungi, demonstrating its potential as a versatile microbial control agent.

Formula: C₁₇H₁₈O₄

Purity: Min. 95%

Molecular weight: 286.32 g/mol

Ref: 3D-XA161658