CAS 63632-58-6

(octyloxy)acetic acid

Description:

(octyloxy)acetic acid, with the CAS number 63632-58-6, is an organic compound characterized by its structure, which includes an octyl group (a long hydrocarbon chain) attached to an acetic acid moiety. This compound is typically a colorless to pale yellow liquid at room temperature and is soluble in organic solvents due to its hydrophobic octyl chain, while also exhibiting some degree of hydrophilicity from the carboxylic acid functional group. The presence of the octyloxy group enhances its surfactant properties, making it useful in various applications, including as an emulsifier or dispersant in formulations. Its chemical behavior is influenced by the carboxylic acid group, which can participate in acid-base reactions, while the octyl group contributes to its hydrophobic characteristics. Additionally, (octyloxy)acetic acid may exhibit low toxicity, but safety data should be consulted for handling and exposure guidelines. Overall, this compound is of interest in both industrial and research settings due to its unique properties and potential applications.

Formula: C₁₀H₂₀O₃

InChI: InChI=1/C10H20O3/c1-2-3-4-5-6-7-8-13-9-10(11)12/h2-9H2,1H3,(H,11,12)

SMILES: CCCCCCCCOCC(=O)O

2-Octoxyacetic acid

CAS: 63632-58-6

Formula: C₁₀H₂₀O₃

Purity: 96%

Color and Shape: Liquid

Molecular weight: 188.2640

Ref: IN-DA00ELWY

2-(Octyloxy)acetic acid

CAS: 63632-58-6

2-(Octyloxy)acetic acid is a fungal metabolite that accumulates in the growth medium of Acinetobacter.

Formula: C₁₀H₂₀O₃

Purity: 97.26%

Color and Shape: Solid

Molecular weight: 188.26

Ref: TM-T84095

2-(Octyloxy)acetic acid

CAS: 63632-58-6

2-(Octyloxy)acetic acid

Purity: 96%

Molecular weight: 188.267g/mol

Ref: 54-OR74497

2-(Octyloxy)acetic acid

CAS: 63632-58-6

2-(Octyloxy)acetic acid

Purity: ≥95%

Molecular weight: 188.26g/mol

Ref: 54-BUP01437

2-(Octyloxy)acetic acid

CAS: 63632-58-6

Purity: 96%

Molecular weight: 188.2669983

Ref: 10-F619693