CAS 63636-89-5
:pyridine-2-sulfonamide
Description:
Pyridine-2-sulfonamide, also known as 2-pyridinesulfonamide, is an organic compound characterized by the presence of a pyridine ring substituted with a sulfonamide group. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. The sulfonamide functional group contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly for its antibacterial properties. Pyridine-2-sulfonamide can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the reactivity of the sulfonamide nitrogen. Its molecular structure allows for hydrogen bonding, which can influence its solubility and interaction with biological targets. Additionally, the compound may exhibit moderate toxicity, necessitating careful handling in laboratory settings. Overall, pyridine-2-sulfonamide serves as a valuable compound in both research and pharmaceutical applications, with ongoing studies exploring its efficacy and mechanisms of action.
Formula:C5H6N2O2S
InChI:InChI=1/C5H6N2O2S/c6-10(8,9)5-3-1-2-4-7-5/h1-4H,(H2,6,8,9)
SMILES:c1ccnc(c1)S(=O)(=O)N
Synonyms:- 2-Pyridinesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyridine-2-sulfonamide
CAS:<p>Pyridine-2-sulfonamide is a synthetic drug that has been shown to inhibit the growth of cancer cells. It binds to the endothelin-A receptor, which is found in many tissues including the heart, brain, and skin. This binding inhibits the binding of epidermal growth factor to its receptor. Pyridine-2-sulfonamide also inhibits pancreatitis by inhibiting the production of hydrogen ions from hydrochloric acid and reducing inflammation. This drug has been shown to be effective against HIV infection.</p>Formula:C5H6N2O2SPurity:Min. 95%Color and Shape:PowderMolecular weight:158.18 g/mol
