CAS 63639-21-4
:2',3',5'-tri-O-acetylcytidine*hydrochloride
Description:
2',3',5'-tri-O-acetylcytidine hydrochloride is a modified nucleoside derivative of cytidine, characterized by the presence of three acetyl groups attached to the hydroxyl groups at the 2', 3', and 5' positions of the ribose sugar. This modification enhances its stability and solubility, making it useful in various biochemical applications, particularly in the synthesis of oligonucleotides and in studies involving RNA. The hydrochloride form indicates that the compound is a salt, which can improve its handling and storage properties. As a nucleoside analog, it may exhibit unique biological activities, including potential antiviral or anticancer properties, although specific biological effects would depend on the context of its use. The compound is typically white to off-white in appearance and is soluble in polar solvents. Its molecular structure allows for participation in hydrogen bonding and interactions with nucleic acids, making it a valuable tool in molecular biology and medicinal chemistry research.
Formula:C15H20ClN3O8
InChI:InChI=1/C15H19N3O8.ClH/c1-7(19)23-6-10-12(24-8(2)20)13(25-9(3)21)14(26-10)18-5-4-11(16)17-15(18)22;/h4-5,10,12-14H,6H2,1-3H3,(H2,16,17,22);1H
SMILES:CC(=O)OCC1C(C(C(n2ccc(=N)nc2O)O1)OC(=O)C)OC(=O)C.Cl
Synonyms:- 4-amino-1-(2,3,5-tri-O-acetylpentofuranosyl)pyrimidin-2(1H)-one hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cytidine, 2',3',5'-triacetate, monohydrochloride
CAS:Formula:C15H20ClN3O8Purity:95%Color and Shape:LiquidMolecular weight:405.7876(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(4-amino-2-oxopyrimidin-1(2H)-yl)tetrahydrofuran-3,4-diyl diacetate hydrochloride
CAS:(2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(4-amino-2-oxopyrimidin-1(2H)-yl)tetrahydrofuran-3,4-diyl diacetate hydrochloridePurity:95%Molecular weight:405.79g/mol2',3',5'-Tri-O-acetylcytidine HCl
CAS:<p>2',3',5'-Tri-O-acetylcytidine HCl is a modified nucleoside that has been shown to have anticancer activity. The cytotoxic effect of 2',3',5'-tri-O-acetylcytidine HCl is mediated by its ability to inhibit DNA synthesis, which leads to cell death. This agent also inhibits viral replication and may be useful in the treatment of herpes virus infections. 2',3',5'-tri-O-acetylcytidine HCl is a stable nucleoside analog that can be used as an activator for polyphosphate polymerase or as a building block for the preparation of phosphoramidites, which are intermediates in the synthesis of oligonucleotide sequences.</p>Formula:C15H19N3O8·HClPurity:Min. 95%Molecular weight:405.79 g/mol



