CAS 63647-04-1

2-(1H-Pyrrol-1-yl)-3-thiophenemethanamine

Description:

2-(1H-Pyrrol-1-yl)-3-thiophenemethanamine, with the CAS number 63647-04-1, is an organic compound characterized by its unique structural features, which include a pyrrole ring and a thiophene moiety. This compound typically exhibits properties associated with both heterocyclic compounds, such as potential biological activity and reactivity due to the presence of nitrogen and sulfur atoms in its structure. The pyrrole ring contributes to its aromatic character, while the thiophene enhances its electronic properties. Such compounds often display interesting pharmacological activities, making them of interest in medicinal chemistry. Additionally, the presence of amine functionality suggests potential for hydrogen bonding and interactions with biological targets. The solubility and stability of this compound can vary depending on the solvent and environmental conditions, which is crucial for its application in research and development. Overall, 2-(1H-Pyrrol-1-yl)-3-thiophenemethanamine represents a class of compounds that may serve as valuable intermediates or active pharmaceutical ingredients in various chemical and biological applications.

Formula: C₉H₁₀N₂S

InChI: InChI=1S/C9H10N2S/c10-7-8-3-6-12-9(8)11-4-1-2-5-11/h1-6H,7,10H2

InChI key: InChIKey=HEEVGWFKDNPKHD-UHFFFAOYSA-N

SMILES: C(N)C1=C(SC=C1)N2C=CC=C2

Synonyms:

• 2-(1H-Pyrrol-1-yl)-3-thiophenemethanamine
• 3-Thiophenemethanamine, 2-(1H-pyrrol-1-yl)-
• [2-(1H-Pyrrol-1-yl)thiophen-3-yl]methanamine

[2-(1H-Pyrrol-1-yl)thiophen-3-yl]methanamine

CAS: 63647-04-1

Versatile small molecule scaffold

Formula: C₉H₁₀N₂S

Purity: Min. 95%

Molecular weight: 178.26 g/mol

Ref: 3D-NCA64704