CAS 63659-18-7: Betaxolol
Description:Betaxolol is a selective beta-1 adrenergic antagonist primarily used in the treatment of hypertension and certain types of glaucoma. As a member of the beta-blocker class, it works by blocking the action of epinephrine on beta-1 receptors in the heart, leading to a decrease in heart rate and cardiac output, which helps lower blood pressure. Betaxolol is characterized by its relatively high selectivity for beta-1 receptors over beta-2 receptors, making it less likely to cause bronchoconstriction, a common side effect associated with non-selective beta-blockers. The substance is typically administered orally or as an ophthalmic solution, with its pharmacokinetics influenced by factors such as absorption, distribution, metabolism, and excretion. Betaxolol is known for its favorable side effect profile, but like all medications, it may cause adverse effects in some patients, including fatigue, dizziness, or bradycardia. Its chemical structure includes a phenoxypropanolamine moiety, contributing to its pharmacological properties.
Formula:C18H29NO3
InChI:InChI=1S/C18H29NO3/c1-14(2)19-11-17(20)13-22-18-7-5-15(6-8-18)9-10-21-12-16-3-4-16/h5-8,14,16-17,19-20H,3-4,9-13H2,1-2H3
InChI key:InChIKey=NWIUTZDMDHAVTP-UHFFFAOYSA-N
SMILES:OC(COC1=CC=C(C=C1)CCOCC2CC2)CNC(C)C
- Synonyms:
- 2-Propanol, 1-[4-[2-(cyclopropylmethoxy)ethyl]phenoxy]-3-[(1-methylethyl)amino]-
- 1-Isopropylamino-3-[4-(2-cyclopropylmethoxy-ethyl)phenoxy]-2-propanol
- Betaxolol
- Betoptic S
- 1-[4-[2-(Cyclopropylmethoxy)ethyl]phenoxy]-3-[(1-methylethyl)amino]-2-propanol
