CAS 63664-40-4

3-oxo-N-(tricyclo[3.3.1.1~3,7~]dec-2-yl)butanamide

Description:

3-Oxo-N-(tricyclo[3.3.1.1^3,7]dec-2-yl)butanamide is a chemical compound characterized by its unique structure, which includes a butanamide moiety and a tricyclic decane framework. The presence of the 3-oxo group indicates that it contains a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The tricyclic structure provides rigidity and may influence the compound's physical properties, such as melting point and solubility. This compound is likely to exhibit specific stereochemical configurations due to the constraints imposed by the tricyclic system, which can affect its biological activity and interactions with other molecules. Additionally, the amide functional group suggests potential for hydrogen bonding, which can play a role in solubility and reactivity. Overall, 3-oxo-N-(tricyclo[3.3.1.1^3,7]dec-2-yl)butanamide is of interest in medicinal chemistry and materials science due to its complex structure and potential functional properties.

Formula: C₁₄H₂₁NO₂

InChI: InChI=1/C14H21NO2/c1-8(16)2-13(17)15-14-11-4-9-3-10(6-11)7-12(14)5-9/h9-12,14H,2-7H2,1H3,(H,15,17)

SMILES: CC(=O)CC(=NC1C2CC3CC(C2)CC1C3)O

N-2-adamantyl-3-oxobutanamide

CAS: 63664-40-4

Purity: 95.0%

Molecular weight: 235.32699584960938

Ref: 10-F314805