CAS 63667-47-0

2-hydroxy-4-propoxybenzaldehyde

Description:

2-Hydroxy-4-propoxybenzaldehyde, with the CAS number 63667-47-0, is an organic compound characterized by the presence of a hydroxyl group (-OH) and an aldehyde group (-CHO) on a benzene ring, along with a propoxy substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and exhibits moderate polarity due to the hydroxyl group. The presence of the aldehyde functional group suggests that it can participate in various chemical reactions, including oxidation and condensation reactions. Additionally, the propoxy group enhances its hydrophobic characteristics, influencing its solubility and reactivity. 2-Hydroxy-4-propoxybenzaldehyde may be used in organic synthesis, as an intermediate in the production of dyes, fragrances, or pharmaceuticals, and may exhibit biological activity, although specific applications would depend on further research into its properties and potential uses. Safety data should be consulted for handling and exposure guidelines.

Formula: C₁₀H₁₂O₃

InChI: InChI=1/C10H12O3/c1-2-5-13-9-4-3-8(7-11)10(12)6-9/h3-4,6-7,12H,2,5H2,1H3

SMILES: CCCOc1ccc(C=O)c(c1)O

Synonyms:

• 2-Hydroxy-4-propoxy-benzaldehyde

2-Hydroxy-4-propoxybenzaldehyde

CAS: 63667-47-0

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₃

Purity: Min. 95%

Molecular weight: 180.2 g/mol

Ref: 3D-NCA66747