CAS 6367-17-5
:(αS)-α-(Acetylamino)-N-methyl-1H-indole-3-propanamide
Description:
The chemical substance known as (αS)-α-(Acetylamino)-N-methyl-1H-indole-3-propanamide, with the CAS number 6367-17-5, is an indole derivative characterized by its unique structural features. This compound contains an indole ring, which is a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of an acetylamino group and a methyl group attached to the nitrogen atom contributes to its chemical reactivity and potential biological activity. The stereochemistry indicated by (αS) suggests that the compound has a specific spatial arrangement, which can influence its interaction with biological targets. This substance may exhibit properties such as solubility in organic solvents and potential pharmacological effects, making it of interest in medicinal chemistry and drug development. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied.
Formula:C14H17N3O2
InChI:InChI=1S/C14H17N3O2/c1-9(18)17-13(14(19)15-2)7-10-8-16-12-6-4-3-5-11(10)12/h3-6,8,13,16H,7H2,1-2H3,(H,15,19)(H,17,18)/t13-/m0/s1
InChI key:InChIKey=DMEAHHGMZZKXFD-ZDUSSCGKSA-N
SMILES:C([C@@H](C(NC)=O)NC(C)=O)C=1C=2C(NC1)=CC=CC2
Synonyms:- 1H-Indole-3-propanamide, α-(acetylamino)-N-methyl-, (αS)-
- Indole-3-propionamide, α-acetamido-N-methyl-, L-
- 1H-indole-3-propanamide, alpha-(acetylamino)-N-methyl-
- N-Acetyl-L-tryptophan methylamide
- (αS)-α-(Acetylamino)-N-methyl-1H-indole-3-propanamide
- 1H-Indole-3-propanamide, α-(acetylamino)-N-methyl-, (S)-
- Nalpha-Acetyl-N-methyltryptophanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ac-Trp-NHMe
CAS:Ac-Trp-NHMe is a hydrogen bond acceptor, which is a functional group that can form hydrogen bonds with other molecules. It is found in proteins and has been extensively studied by protein data bank. The amide group of Ac-Trp-NHMe forms a hydrogen bond with the carbonyl group of the amino acid tryptophan. The molecule has been used as a model system for studying the fluorescence properties of tryptophan, and to understand vibrational spectra. Ac-Trp-NHMe has also been shown to be an important chemical in plants, where it is involved in the formation of the dry weight of plants and water molecules.Formula:C14H17N3O2Purity:Min. 95%Molecular weight:259.3 g/molAc-Trp-NHMe
CAS:NATMA and NATA served as peptide model for studying hydration and solution dynamics of peptides and proteins.Formula:C14H17N3O2Purity:> 98%Color and Shape:White PowderMolecular weight:259.31

