CAS 6367-36-8
:tert-butyl azidoacetate
Description:
Tert-butyl azidoacetate is an organic compound characterized by its azido and ester functional groups. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound features a tert-butyl group, which contributes to its steric bulk, and an azido group (-N3), known for its reactivity and potential for explosive behavior under certain conditions. Tert-butyl azidoacetate is soluble in organic solvents such as ether and dichloromethane but is generally insoluble in water due to its hydrophobic tert-butyl moiety. It is often used in organic synthesis, particularly in the preparation of azides and other nitrogen-containing compounds. Safety precautions are essential when handling this substance, as azides can be sensitive to heat, shock, and friction, posing risks of detonation. Proper storage in a cool, dry place away from incompatible materials is crucial to ensure stability and safety. Overall, tert-butyl azidoacetate is a valuable reagent in synthetic organic chemistry, but it requires careful handling due to its reactive nature.
Formula:C6H11N3O2
InChI:InChI=1/C6H11N3O2/c1-6(2,3)11-5(10)4-8-9-7/h4H2,1-3H3
SMILES:CC(C)(C)OC(=O)CN=[N+]=[NH-]
Synonyms:- 2-Methyl-2-propanyl azidoacetate
- Acetic Acid, 2-Azido-, 1,1-Dimethylethyl Ester
- Acetic acid, azido-, 1,1-dimethylethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
tert-Butyl 2-azidoacetate
CAS:Formula:C6H11N3O2Purity:95%Color and Shape:LiquidMolecular weight:157.1704tert-Butyl 2-azidoacetate
CAS:Tert-butyl 2-azidoacetate is a synthetic chemical that is used to synthesize azides. It reacts with ethyl diazoacetate to produce tert-butyl azide and tert-butanol. This reaction can be used to synthesize the azide functional group in a single step, which is more efficient than the traditional two-step process. Tert-butyl 2-azidoacetate has been shown to have antibacterial activity against hl-60 cells, an immortalized promyelocytic leukemia cell line. The antibacterial effect of tert-butyl 2-azidoacetate may be due to its ability to react with amino groups on proteins and phosphonates on DNA, which are important for bacterial growth and replication.
Formula:C6H11N3O2Purity:Min. 95%Molecular weight:157.17 g/mol

