CAS 63671-68-1

(2-Hydroxybenzyl)(2-pyridylmethyl)amine

Description:

(2-Hydroxybenzyl)(2-pyridylmethyl)amine, with the CAS number 63671-68-1, is an organic compound characterized by the presence of both a hydroxyl group and an amine functional group, which contribute to its reactivity and potential applications. This compound features a benzyl moiety substituted with a hydroxyl group at the ortho position relative to the amine, and a pyridyl group that enhances its ability to form coordination complexes with metal ions. The presence of the hydroxyl group can impart hydrogen bonding capabilities, influencing solubility and interaction with biological systems. Additionally, the pyridine ring can participate in various chemical reactions, making this compound of interest in medicinal chemistry and materials science. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways or as a ligand in coordination chemistry. Overall, the unique combination of functional groups in (2-Hydroxybenzyl)(2-pyridylmethyl)amine makes it a versatile compound for further research and application in various fields.

Formula: C₁₃H₁₄N₂O

InChI: InChI=1S/C13H14N2O/c16-13-7-2-1-5-11(13)9-14-10-12-6-3-4-8-15-12/h1-8,14,16H,9-10H2

InChI key: InChIKey=QKSKEROUBXANPB-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=N1)C2=C(O)C=CC=C2

Synonyms:

• (2-Hydroxybenzyl)(2-pyridylmethyl)amine
• Phenol, 2-[[(2-pyridinylmethyl)amino]methyl]-
• N-(o-Hydroxybenzyl)-2-(aminomethyl)pyridine
• 2-[[(2-Pyridinylmethyl)amino]methyl]phenol
• 2-[[2-Pyridinylmethyl)amino]methyl]phenol
• 2-{[(pyridin-2-ylmethyl)amino]methyl}phenol

2-{[(pyridin-2-ylmethyl)amino]methyl}phenol

Controlled Product

CAS: 63671-68-1

Formula: C₁₃H₁₄N₂O

Color and Shape: Neat

Molecular weight: 214.26

Ref: TR-A576348

2-{[(Pyridin-2-ylmethyl)amino]methyl}phenol

CAS: 63671-68-1

2-{[(Pyridin-2-ylmethyl)amino]methyl}phenol is a ligand that crystallizes in the monoclinic space group P21/c. The compound crystallizes with two molecules per asymmetric unit, and contains one water molecule per molecule. It has been shown to have cyclic voltammetry, which includes cyclic voltammetry and linear sweep voltammetry. 2-{[(Pyridin-2-ylmethyl)amino]methyl}phenol binds to the perchlorate ion and oxygen atoms coordinate to the nitrogen atoms of the ligand.

Formula: C₁₃H₁₄N₂O

Purity: Min. 95%

Molecular weight: 214.26 g/mol

Ref: 3D-NCA67168