CymitQuimica logo

CAS 63674-11-3

:

N-(4-methoxybenzyl)cyclohexanamine

Description:
N-(4-methoxybenzyl)cyclohexanamine is an organic compound characterized by its cyclohexane structure substituted with an amine group and a 4-methoxybenzyl moiety. This compound features a cyclohexane ring, which contributes to its cyclic structure and potential conformational flexibility. The presence of the amine group (-NH2) indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The 4-methoxybenzyl group, derived from a methoxy-substituted benzene, adds aromatic characteristics and can enhance lipophilicity, potentially affecting the compound's biological activity and interaction with various receptors. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can influence pharmacokinetics and pharmacodynamics. Additionally, the methoxy group can affect electronic properties, making it a point of interest in studies related to drug design and synthesis. Overall, N-(4-methoxybenzyl)cyclohexanamine presents a unique combination of structural elements that may be explored for various chemical and biological applications.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c1-16-14-9-7-12(8-10-14)11-15-13-5-3-2-4-6-13/h7-10,13,15H,2-6,11H2,1H3
SMILES:COc1ccc(cc1)CNC1CCCCC1
Synonyms:
  • benzenemethanamine, N-cyclohexyl-4-methoxy-
  • Cyclohexyl-(4-methoxy-benzyl)-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.