CAS 63674-54-4

1-(2-ethyl-6-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid

Description:

1-(2-Ethyl-6-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid, with the CAS number 63674-54-4, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered cyclic amine, and is characterized by the presence of a carboxylic acid functional group and a ketone group at specific positions on the ring. The presence of the 2-ethyl-6-methylphenyl substituent contributes to its unique structural and electronic properties, potentially influencing its reactivity and interactions. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₄H₁₇NO₃

InChI: InChI=1/C14H17NO3/c1-3-10-6-4-5-9(2)13(10)15-8-11(14(17)18)7-12(15)16/h4-6,11H,3,7-8H2,1-2H3,(H,17,18)

SMILES: CCc1cccc(C)c1N1CC(CC1=O)C(=O)O

Synonyms:

• 3-Pyrrolidinecarboxylic Acid, 1-(2-Ethyl-6-Methylphenyl)-5-Oxo-

1-(2-ethyl-6-methylphenyl)-5-oxo-3-pyrrolidinecarboxylic acid

CAS: 63674-54-4

Formula: C₁₄H₁₇NO₃

Purity: 95.0%

Molecular weight: 247.294

Ref: 10-F316198