CAS 63674-58-8
:1-[4-(1-Methylpropyl)phenyl]-5-oxo-3-pyrrolidinecarboxylic acid
Description:
1-[4-(1-Methylpropyl)phenyl]-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 63674-58-8, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered cyclic amine, and is substituted with a phenyl group that has a branched alkyl chain (1-methylpropyl) at the para position. The presence of a carboxylic acid functional group and a ketone (5-oxo) contributes to its reactivity and potential biological activity. The compound may exhibit properties such as being a potential intermediate in organic synthesis or having pharmacological significance, although specific biological activities would require further investigation. Its molecular structure suggests it may participate in various chemical reactions, including esterification and amide formation. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its stability and potential toxicity.
Formula:C15H19NO3
InChI:InChI=1S/C15H19NO3/c1-3-10(2)11-4-6-13(7-5-11)16-9-12(15(18)19)8-14(16)17/h4-7,10,12H,3,8-9H2,1-2H3,(H,18,19)
InChI key:InChIKey=QQDZRLNEBVHNOB-UHFFFAOYSA-N
SMILES:O=C1N(CC(C(O)=O)C1)C2=CC=C(C(CC)C)C=C2
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-[4-(1-methylpropyl)phenyl]-5-oxo-
- 1-(4-Butan-2-ylphenyl)-5-oxopyrrolidine-3-carboxylic acid
- 1-[4-(1-Methylpropyl)phenyl]-5-oxo-3-pyrrolidinecarboxylic acid
- 1-[4-(Butan-2-yl)phenyl]-5-oxopyrrolidine-3-carboxylic acid
- 1-(4-sec-Butyl-phenyl)-5-oxo-pyrrolidine-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.