CAS 63674-70-4

1-[3-(Aminosulfonyl)phenyl]-5-oxo-3-pyrrolidinecarboxylic acid

Description:

1-[3-(Aminosulfonyl)phenyl]-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 63674-70-4, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring, a carboxylic acid group, and a phenyl group substituted with an aminosulfonyl moiety. This compound typically exhibits properties such as solubility in polar solvents, which is influenced by the presence of the carboxylic acid and sulfonamide functional groups. It may demonstrate biological activity, potentially acting as an intermediate in pharmaceutical synthesis or as a bioactive molecule. The presence of the aminosulfonyl group suggests potential interactions with biological systems, possibly influencing enzyme activity or receptor binding. Additionally, the compound's stability and reactivity can be affected by pH and temperature, making it important to consider these factors in practical applications. Overall, this compound's structural features contribute to its potential utility in medicinal chemistry and related fields.

Formula: C₁₁H₁₂N₂O₅S

InChI: InChI=1S/C11H12N2O5S/c12-19(17,18)9-3-1-2-8(5-9)13-6-7(11(15)16)4-10(13)14/h1-3,5,7H,4,6H2,(H,15,16)(H2,12,17,18)

InChI key: InChIKey=OQZBIRJTOGZMCR-UHFFFAOYSA-N

SMILES: O=C1N(CC(C(O)=O)C1)C2=CC(S(N)(=O)=O)=CC=C2

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-[3-(aminosulfonyl)phenyl]-5-oxo-
• 1-[3-(Aminosulfonyl)phenyl]-5-oxo-3-pyrrolidinecarboxylic acid

5-Oxo-1-(3-sulfamoylphenyl)pyrrolidine-3-carboxylic acid

CAS: 63674-70-4

Versatile small molecule scaffold

Formula: C₁₁H₁₂N₂O₅S

Purity: Min. 95%

Molecular weight: 284.29 g/mol

Ref: 3D-NCA67470