CAS 63675-73-0
:1-(4-Methoxyphenyl)-2-[(3-methoxyphenyl)thio]ethanone
Description:
1-(4-Methoxyphenyl)-2-[(3-methoxyphenyl)thio]ethanone, with the CAS number 63675-73-0, is an organic compound characterized by its complex structure featuring a ketone functional group and thioether linkage. This compound typically exhibits a moderate to high molecular weight and is soluble in organic solvents due to its aromatic components. The presence of methoxy groups enhances its lipophilicity, potentially influencing its biological activity and reactivity. It may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's stability is generally good under standard conditions, although it may be sensitive to strong acids or bases. Its synthesis often involves multi-step organic reactions, including electrophilic aromatic substitution and thioether formation. As with many organic compounds, safety precautions should be taken when handling it, as it may pose risks such as irritation or toxicity. Overall, this compound represents a unique structure that could be explored for various applications in research and industry.
Formula:C16H16O3S
InChI:InChI=1S/C16H16O3S/c1-18-13-8-6-12(7-9-13)16(17)11-20-15-5-3-4-14(10-15)19-2/h3-10H,11H2,1-2H3
InChI key:InChIKey=CXSKVBXJDSVPKS-UHFFFAOYSA-N
SMILES:S(CC(=O)C1=CC=C(OC)C=C1)C2=CC(OC)=CC=C2
Synonyms:- S-(3-Methoxyphenyl) 4-methoxybenzenecarbothioate
- 2-(3-Methoxyphenylthio)-4′-methoxyacetophenone
- 1-(4-Methoxyphenyl)-2-[(3-methoxyphenyl)thio]ethanone
- Ethanone, 1-(4-methoxyphenyl)-2-[(3-methoxyphenyl)thio]-
- 1-(4-Methoxyphenyl)-2-(3-methoxyphenyl)sulfanylethanone
- 1-(4-Methoxyphenyl)-2-[(3-methoxyphenyl)sulfanyl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-(4-Methoxyphenyl)-2-((3-methoxyphenyl)-thio)ethanone
CAS:Controlled ProductFormula:C16H16O3SColor and Shape:NeatMolecular weight:288.361


