CAS 63697-61-0
:(4-azido-2,2,6,6-tetramethylpiperidin-1-yl)oxidanyl
Description:
(4-Azido-2,2,6,6-tetramethylpiperidin-1-yl)oxidanyl, with the CAS number 63697-61-0, is a chemical compound characterized by the presence of an azido group (-N3) and a piperidine ring that is heavily substituted with four methyl groups. This structure contributes to its unique properties, including stability and reactivity. The azido group is known for its ability to participate in various chemical reactions, particularly in click chemistry and as a potential precursor for nitrogen-containing compounds. The presence of the oxidanyl (hydroxyl) group indicates that the compound has a hydroxyl functional group, which can influence its solubility and reactivity in different solvents. The bulky tetramethyl substituents on the piperidine ring may also affect the steric hindrance and overall molecular interactions. Overall, this compound is of interest in organic synthesis and materials science, particularly in the development of functionalized polymers and other advanced materials.
Formula:C9H17N4O
InChI:InChI=1/C9H17N4O/c1-8(2)5-7(11-12-10)6-9(3,4)13(8)14/h7H,5-6H2,1-4H3
SMILES:CC1(C)CC(CC(C)(C)N1#[OH2+])NN=[NH-]
Synonyms:- 4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy
CAS:4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxyPurity:98%Molecular weight:197.26g/mol4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy
CAS:Controlled ProductApplications An intermediate in the preparation of 4-Amino-2,2,6,6-tetra-methyl Piperidine-1-oxyl.
References Li, W., et al.: J. Pharm. Pharmacol., 58, 941 (2006),Formula:C9H17N4OColor and Shape:Orange SolidMolecular weight:197.264-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy
CAS:4-Azido-2,2,6,6-tetramethyl-1-piperidinyloxy is a fine chemical that is a versatile building block useful in research and synthesis. It has been used as a reaction component in the preparation of other compounds. This compound is also an intermediate for the production of other chemicals.Formula:C9H17N4OPurity:Min. 95%Color and Shape:PowderMolecular weight:197.26 g/molN3-TEMPO
CAS:N3-TEMPO, a click chemistry reagent featuring an azide group, exhibits significant potential in facilitating connections among nucleic acids, lipids, proteins, and various molecules. Its application across numerous research domains is attributed to advantageous traits such as high yield, high specificity, and simplicity [1].Formula:C9H17N4OColor and Shape:SolidMolecular weight:197.26



