CAS 63698-52-2

5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2(3H)-thione

Description:

5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. This compound features a benzodioxole moiety, contributing to its aromatic character and potential biological activity. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom within the oxadiazole structure, which can influence the compound's reactivity and stability. Typically, compounds of this nature may exhibit interesting pharmacological properties, including antimicrobial or anticancer activities, due to their unique structural features. The presence of the benzodioxole group may also enhance solubility and bioavailability. Additionally, the compound's synthesis and characterization often involve various organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, 5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazole-2(3H)-thione represents a class of compounds with potential applications in medicinal chemistry and materials science.

Formula: C₉H₆N₂O₃S

InChI: InChI=1/C9H6N2O3S/c15-9-11-10-8(14-9)5-1-2-6-7(3-5)13-4-12-6/h1-3H,4H2,(H,11,15)

Synonyms:

• 5-Benzo[1,3]dioxol-5-yl-[1,3,4]oxadiazole-2-thiol

5-(1,3-Dioxaindan-5-yl)-1,3,4-oxadiazole-2-thiol

CAS: 63698-52-2

Versatile small molecule scaffold

Formula: C₉H₆N₂O₃S

Purity: Min. 95%

Molecular weight: 222.22 g/mol

Ref: 3D-NCA69852