CAS 63699-78-5
:Benzoic acid, 5-[(4-amino-4-carboxy-1-oxobutyl)amino]-2-nitro-, monoammonium salt, (S)-
Description:
Benzoic acid, 5-[(4-amino-4-carboxy-1-oxobutyl)amino]-2-nitro-, monoammonium salt, (S)-, is a complex organic compound characterized by its functional groups, including a benzoic acid moiety, an amino group, and a nitro group. This compound is typically a white to off-white solid and is soluble in water due to the presence of the ammonium salt, which enhances its solubility compared to its non-salt forms. The presence of the amino and carboxylic acid groups suggests that it can participate in various chemical reactions, including acid-base reactions and potential interactions with biological systems. Its chirality, indicated by the (S)- designation, implies that it may exhibit specific biological activity or pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 63699-78-5, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and biochemistry.
Formula:C12H13N3O7·H3N
InChI:InChI=1S/C12H13N3O7.H3N/c13-8(12(19)20)2-4-10(16)14-6-1-3-9(15(21)22)7(5-6)11(17)18;/h1,3,5,8H,2,4,13H2,(H,14,16)(H,17,18)(H,19,20);1H3/t8-;/m0./s1
InChI key:InChIKey=GFABNNMTRVBLPZ-QRPNPIFTSA-N
SMILES:C(O)(=O)C1=C(N(=O)=O)C=CC(NC(CC[C@@H](C(O)=O)N)=O)=C1.N
Synonyms:- Benzoic acid, 5-[(4-amino-4-carboxy-1-oxobutyl)amino]-2-nitro-, monoammonium salt, (S)-
- L-glutamic acid gamma-(3-carboxy-4-nitroanilide) ammonium salt
- γ-GT
- γ-L-Glutamyl-3-carboxy-4-nitroanilide, monoammonium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Glutamic Acid γ-(3-Carboxy-4-Nitroanilide) Ammonium Salt
CAS:Formula:C12H16N4O7Purity:98%Color and Shape:SolidMolecular weight:328.2780L-Glutamic acid γ-(3-carboxy-4- nitroanilide) A
CAS:Formula:C12H12N3O7NH4Purity:≥ 98.0%Color and Shape:White to light yellow powderMolecular weight:328.28L-Glutamic acid γ-(3-carboxy-4-nitroanilide) ammonium salt
CAS:L-Glutamic acid γ-(3-carboxy-4-nitroanilide) ammonium saltPurity:98%Molecular weight:328.28g/molγ-GT
CAS:γ-GT (H-GLA(PNA)-OH) is used as a synthetic substrate for gamma-glutamyltransferase (GGT) to determine GGT activity.Formula:C12H16N4O7Purity:98.12% - 99.8%Color and Shape:Yellowish Micr°Crystalline PowderMolecular weight:328.28L-Glutamic acid gamma-(3-carboxy-4-nitroanilide) ammonium salt
CAS:L-Glutamic acid gamma-(3-carboxy-4-nitroanilide) ammonium salt has been used as a synthetic substrate for gamma-glutamyltransferase (GGT) to determine GGT activity.Formula:C12H16N4O7Purity:Min. 99 Area-%Color and Shape:White PowderMolecular weight:328.28 g/molL-γ-Glutamyl-3-Carboxy-4-Nitroanilide (Glupa) extrapure, 99%
CAS:Formula:C12H12N3O7NH4Purity:min. 99.0%Color and Shape:White to Light yellow, Crystalline powder, ClearMolecular weight:328.28






