CAS 637-84-3: N-[N-(N-glycylglycyl)glycyl]glycine
Description:N-[N-(N-glycylglycyl)glycyl]glycine, also known by its CAS number 637-84-3, is a peptide compound characterized by its structure, which consists of multiple glycine residues linked together. This compound is a derivative of glycine, the simplest amino acid, and features a sequence that includes glycyl groups, indicating that it is a peptide with potential biological activity. It is typically white to off-white in appearance and is soluble in water, which is a common characteristic of many peptides. The presence of multiple amine and carboxylic acid functional groups contributes to its ability to form hydrogen bonds, influencing its solubility and reactivity. This compound may be of interest in biochemical research, particularly in studies related to peptide synthesis, protein interactions, and potential therapeutic applications. Its stability and behavior in biological systems can vary based on environmental conditions such as pH and temperature. As with many peptides, it may also exhibit specific biological activities, although detailed studies would be necessary to elucidate these properties fully.
Formula:C8H14N4O5
InChI:InChI=1/C8H14N4O5/c9-1-5(13)10-2-6(14)11-3-7(15)12-4-8(16)17/h1-4,9H2,(H,10,13)(H,11,14)(H,12,15)(H,16,17)
- Synonyms:
- Glycyl-glycyl-glycyl-glycine
- Nsc 89178
- Tetraglycine
- N-(N-(N-Glycylglycyl)glycyl)glycine
![N-[N-(N-glycylglycyl)glycyl]glycine](https://static.cymitquimica.com/cas-image/341105-n-n-n-glycylglycyl-glycyl-glycine.png)
