CAS 6370-32-7
:2-Hydroxy-4,6-dimethylbenzoic acid
Description:
2-Hydroxy-4,6-dimethylbenzoic acid, also known as salicylic acid derivative, is an aromatic carboxylic acid characterized by the presence of a hydroxyl group and two methyl groups on a benzoic acid framework. Its molecular structure features a benzene ring substituted with a hydroxyl (-OH) group at the ortho position and two methyl (-CH3) groups at the meta positions. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and higher solubility in organic solvents. It possesses acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the hydroxyl group contributes to its potential as a phenolic antioxidant and its utility in various applications, including pharmaceuticals and cosmetics. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H10O3
InChI:InChI=1S/C9H10O3/c1-5-3-6(2)8(9(11)12)7(10)4-5/h3-4,10H,1-2H3,(H,11,12)
InChI key:InChIKey=OQDPLEDHXOOBPW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(C)C=C1O
Synonyms:- 2,4-Dimethyl-6-hydroxybenzoic acid
- 6-Hydroxy-2,4-xylic acid
- Benzoic acid, 2-hydroxy-4,6-dimethyl-
- Salicylic acid, 4,6-dimethyl-
- 2-Hydroxy-4,6-dimethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,6-dimethylsalicylic acid
CAS:Formula:C9H10O3Purity:97%Color and Shape:SolidMolecular weight:166.17392-Hydroxy-4,6-dimethylbenzoic acid
CAS:2-Hydroxy-4,6-dimethylbenzoic acidPurity:97%Molecular weight:166.17g/mol2-Hydroxy-4,6-dimethylbenzoic acid
CAS:<p>2-Hydroxy-4,6-dimethylbenzoic acid (HMBA) is a tumor treatment drug that can be used in combination with other drugs. HMBA inhibits proton pumps and the synthesis of DNA, RNA, and protein. The proton pump inhibitors are used to treat acid reflux disease, ulcers, and gastroesophageal reflux disease. HMBA has been shown to significantly inhibit tumor growth in animal studies. This drug also has anti-inflammatory effects and may be useful for treating arthritis.</p>Formula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/mol




