CAS 6370-33-8
:Benzenamine, 4,4′-(phenylmethylene)bis[2,5-dimethyl-
Description:
Benzenamine, 4,4′-(phenylmethylene)bis[2,5-dimethyl-] is an organic compound characterized by its amine functional group and a complex structure featuring a bis(2,5-dimethylphenyl) moiety linked by a phenylmethylene bridge. This compound typically appears as a solid at room temperature and is soluble in organic solvents due to its hydrophobic aromatic rings. Its molecular structure suggests potential applications in the synthesis of dyes, pharmaceuticals, or as intermediates in organic reactions. The presence of multiple methyl groups contributes to its steric hindrance, which can influence its reactivity and interactions with other chemical species. Additionally, the compound may exhibit specific optical properties due to its conjugated system, making it of interest in materials science and organic electronics. Safety data should be consulted, as amines can be hazardous, and appropriate handling and storage conditions are necessary to mitigate risks associated with exposure.
Formula:C23H26N2
InChI:InChI=1S/C23H26N2/c1-14-12-21(24)16(3)10-19(14)23(18-8-6-5-7-9-18)20-11-17(4)22(25)13-15(20)2/h5-13,23H,24-25H2,1-4H3
InChI key:InChIKey=FHZDGQOFZGFKSC-UHFFFAOYSA-N
SMILES:C(C1=C(C)C=C(N)C(C)=C1)(C2=C(C)C=C(N)C(C)=C2)C3=CC=CC=C3
Synonyms:- 2,2′,5,5′-Tetramethyl-4,4′-benzylidenedianiline
- Benzenamine, 4,4′-(phenylmethylene)bis[2,5-dimethyl-
- 2,5-Xylidine, 4,4′-benzylidenedi-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4,4'-Benzylidenedi-2,5-xylidine
CAS:Controlled ProductFormula:C23H26N2Color and Shape:NeatMolecular weight:330.466
