CAS 63700-38-9
:N-{4-amino-2-[(6-methyloctanoyl)amino]butanoyl}threonyl-N-[6,9,18-tris(2-aminoethyl)-15-benzyl-3,12-bis(1-hydroxyethyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl]serinamide
Description:
The chemical substance N-{4-amino-2-[(6-methyloctanoyl)amino]butanoyl}threonyl-N-[6,9,18-tris(2-aminoethyl)-15-benzyl-3,12-bis(1-hydroxyethyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptaazacyclotricosan-21-yl]serinamide, with CAS number 63700-38-9, is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and a large molecular framework. This substance features amino acids and a heptaazacyclotricosane core, indicating potential applications in biochemistry and medicinal chemistry, particularly in drug design or delivery systems. The presence of various amino acid residues suggests that it may exhibit biological activity, possibly interacting with specific receptors or enzymes. Its structural complexity may also contribute to unique solubility and stability properties, making it of interest for research in pharmaceutical formulations. Additionally, the presence of multiple functional groups allows for potential modifications, which could enhance its efficacy or specificity in therapeutic applications. Overall, this compound exemplifies the intersection of organic chemistry and biochemistry, highlighting the potential for innovative applications in health sciences.
Formula:C53H91N15O15
InChI:InChI=1/C53H91N15O15/c1-6-28(2)12-10-11-15-40(73)59-33(16-21-54)47(77)67-43(31(5)72)53(83)65-39(27-69)50(80)62-37-20-25-58-51(81)41(29(3)70)66-48(78)36(19-24-57)61-44(74)35(18-23-56)63-52(82)42(30(4)71)68-49(79)38(26-32-13-8-7-9-14-32)64-45(75)34(17-22-55)60-46(37)76/h7-9,13-14,28-31,33-39,41-43,69-72H,6,10-12,15-27,54-57H2,1-5H3,(H,58,81)(H,59,73)(H,60,76)(H,61,74)(H,62,80)(H,63,82)(H,64,75)(H,65,83)(H,66,78)(H,67,77)(H,68,79)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Polymyxin S1
CAS:Polymyxin S1, produced by Bacillus polymyxa RS-6, exhibits resistance against Gram-positive bacteria.Formula:C53H91N15O15Color and Shape:SolidMolecular weight:1178.38
