
CAS 63710-09-8
:Musettamycin
Description:
Musettamycin, with the CAS number 63710-09-8, is a naturally occurring antibiotic that belongs to the class of compounds known as nucleoside antibiotics. It is primarily derived from the fermentation of certain strains of Streptomyces bacteria. Musettamycin exhibits potent antibacterial activity, particularly against a range of Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic development. The compound's structure features a nucleoside backbone, which is crucial for its biological activity, allowing it to interfere with bacterial RNA synthesis. Musettamycin's mechanism of action involves inhibition of RNA polymerase, thereby disrupting the transcription process in susceptible bacteria. Additionally, it has been studied for its potential applications in cancer therapy due to its ability to inhibit cell proliferation. However, like many antibiotics, the emergence of resistance poses challenges to its clinical use. Overall, Musettamycin represents a significant compound in the ongoing search for effective antimicrobial agents.
Formula:C36H45NO14
InChI:InChI=1S/C36H45NO14/c1-7-36(46)13-22(50-23-11-18(37(4)5)34(15(3)49-23)51-24-12-21(40)30(41)14(2)48-24)25-16(29(36)35(45)47-6)10-17-26(32(25)43)33(44)28-20(39)9-8-19(38)27(28)31(17)42/h8-10,14-15,18,21-24,29-30,34,38-41,43,46H,7,11-13H2,1-6H3/t14-,15-,18-,21-,22-,23-,24-,29-,30+,34+,36+/m0/s1
InChI key:InChIKey=PXKJRTZJMGPOGS-HSCQWZBZSA-N
SMILES:O([C@@H]1C2=C([C@@H](C(OC)=O)[C@](CC)(O)C1)C=C3C(=C2O)C(=O)C=4C(C3=O)=C(O)C=CC4O)[C@H]5C[C@H](N(C)C)[C@H](O[C@H]6C[C@H](O)[C@H](O)[C@H](C)O6)[C@H](C)O5
Synonyms:- 1-Naphthacenecarboxylic acid, 2-ethyl-1,2,3,4,6,11-hexahydro-2,5,7,10-tetrahydroxy-6,11-dioxo-4-[[2,3,6-trideoxy-4-O-(2,6-dideoxy-α-L-lyxo-hexopyranosyl)-3-(dimethylamino)-α-L-lyxo-hexopyranosyl]oxy]-, methyl ester, (1R,2R,4S)-
- Antibiotic MA 144S2
- 1-Hydroxy-MA144 S1
- Musettamycin
- 1-Naphthacenecarboxylic acid, 2-ethyl-1,2,3,4,6,11-hexahydro-2,5,7,10-tetrahydroxy-6,11-dioxo-4-[[2,3,6-trideoxy-4-O-(2,6-dideoxy-α-L-lyxo-hexopyranosyl)-3-(dimethylamino)-α-L-lyxo-hexopyranosyl]oxy]-, methyl ester, [1R-(1α,2β,4β)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Musettamycin
CAS:Musettamycin triggers erythroid differentiation in blood cells, acts like anthracycline antibiotics, but only inhibits gram-positive bacteria.Formula:C36H45NO14Color and Shape:SolidMolecular weight:715.74
