CAS 63725-51-9

6-chloro-1H-pyrazolo[3,4-b]pyridine

Description:

6-Chloro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position of the pyrazole ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various substitution reactions, which can lead to the synthesis of derivatives with altered pharmacological properties. Additionally, 6-chloro-1H-pyrazolo[3,4-b]pyridine may participate in coordination chemistry, forming complexes with transition metals. The compound's stability and reactivity can be influenced by factors such as pH and temperature, making it a versatile building block in organic synthesis. Overall, its unique structural features and reactivity profile make it a valuable compound in both research and industrial applications.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-5-2-1-4-3-8-10-6(4)9-5/h1-3H,(H,8,9,10)

SMILES: c1cc(Cl)nc2c1c[nH]n2

Synonyms:

• 1H-pyrazolo[3,4-b]pyridine, 6-chloro-
• 6-Chloro-1H-pyrazolo[3,4-b]pyridine 98%
• 6-chloro-1H-pyrazolo[3,4-b]pyridine
• 6-Chloro-1H-pyrazolo[3,4-...
• 7-Aza-6-chloro-1H-indazole
• 6-Chlor-1H-pyrazolo<3,4-b>pyridin
• 6-chloro-1H-pyrazolo[3

6-chloro-1H-pyrazolo[3,4-b]pyridine

CAS: 63725-51-9

Formula: C₆H₄ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA00EI6W

6-Chloro-1H-pyrazolo[3,4-b]pyridine

CAS: 63725-51-9

6-Chloro-1H-pyrazolo[3,4-b]pyridine

Formula: C₆H₄ClN₃

Purity: 98%

Color and Shape: yellow-brown solid

Molecular weight: 153.57g/mol

Ref: 54-OR61201

6-Chloro-1H-pyrazolo[3,4-b]pyridine

CAS: 63725-51-9

6-Chloro-1H-pyrazolo[3,4-b]pyridine (6CPD) is a synthetic compound that acts as a cation channel blocker. 6CPD has been shown to inhibit fatty acid oxidation and cardiac uptake of fatty acids in the heart by blocking the uptake of fatty acids into the mitochondria. 6CPD also inhibits the proton uptake in the mitochondria and reduces oxygen consumption. The compound can be transplacental, which means it crosses the placenta from mother to fetus, which may cause fetal death. 6CPD is an endogenous compound that is involved in death by reducing cell proliferation and inhibiting DNA synthesis.

Formula: C₆H₄ClN₃

Purity: Min. 95%

Molecular weight: 153.57 g/mol

Ref: 3D-NCA72551

6-Chloro-1H-pyrazolo[3,4-b]pyridine

CAS: 63725-51-9

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F077665