CAS 63729-98-6
:Flamprop M-methyl
Description:
Flamprop M-methyl, with the CAS number 63729-98-6, is a chemical compound primarily used as a herbicide in agricultural applications. It belongs to the class of compounds known as phenoxy herbicides, which are characterized by their ability to mimic natural plant hormones, leading to uncontrolled growth and eventual death of target weeds. Flamprop M-methyl is particularly effective against a range of broadleaf weeds and is often employed in cereal crops. The compound exhibits systemic properties, allowing it to be absorbed by the plant and translocated throughout its tissues. Its mode of action involves disrupting the normal growth processes of the plants it targets. Flamprop M-methyl is typically applied in specific formulations that enhance its efficacy and stability in the environment. As with many herbicides, it is essential to follow safety guidelines and regulations regarding its use to minimize potential environmental impact and ensure human safety. Proper handling and application practices are crucial to mitigate risks associated with herbicide use.
Formula:C17H15ClFNO3
InChI:InChI=1S/C17H15ClFNO3/c1-11(17(22)23-2)20(13-8-9-15(19)14(18)10-13)16(21)12-6-4-3-5-7-12/h3-11H,1-2H3/t11-/m1/s1
InChI key:InChIKey=RBNIGDFIUWJJEV-LLVKDONJSA-N
SMILES:N(C(=O)C1=CC=CC=C1)([C@@H](C(OC)=O)C)C2=CC(Cl)=C(F)C=C2
Synonyms:- 63729-98-6
- <span class="text-smallcaps">D</span>-Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-, methyl ester
- <span class="text-smallcaps">D</span>-Mataven
- Flamprop M-methyl
- Methyl (2R)-2-[benzoyl(3-chloro-4-fluorophenyl)amino]propanoate
- Methyl N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alaninate
- Methyl-N-benzoyl-N-(3-chlor-4-fluorphenyl)-D-alaninat
- N-Benzoyl-N-(3-chloro-4-fluorophényl)-D-alaninate de méthyle
- R-Flamprop-methyl
- D-Mataven
- D-Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Flamprop-M-methyl
CAS:Controlled ProductFormula:C17H15ClFNO3Color and Shape:NeatMolecular weight:335.76
