CymitQuimica logo

CAS 6373-33-7

:

1,2-Dihydro-5-acenaphthylenol

Description:
1,2-Dihydro-5-acenaphthylenol, with the CAS number 6373-33-7, is an organic compound characterized by its acenaphthylene structure, which consists of a fused bicyclic system. This compound features a hydroxyl group (-OH) attached to a carbon atom in the acenaphthylene framework, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the hydroxyl group allows for hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, 1,2-Dihydro-5-acenaphthylenol may participate in various chemical reactions, including oxidation and substitution, making it of interest in the fields of medicinal chemistry and materials science. Its unique structure and functional group can also impart specific biological activities, warranting further investigation into its potential uses in pharmaceuticals or as a precursor in chemical synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H10O
InChI:InChI=1S/C12H10O/c13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7,13H,4-5H2
InChI key:InChIKey=LXFFOCVQYSQIQO-UHFFFAOYSA-N
SMILES:OC1=C2C3=C(CCC3=CC=C2)C=C1
Synonyms:
  • 5-Acenaphthylenol, 1,2-dihydro-
  • 5-Hydroxyacenaphthene
  • 5-Acenaphthenol
  • 1,2-Dihydro-5-acenaphthylenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.