CAS 63732-46-7
:(5alpha,6alpha)-6-bromo-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3-ol
Description:
The chemical substance known as (5alpha,6alpha)-6-bromo-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3-ol, with the CAS number 63732-46-7, is a synthetic derivative of morphinan, a class of compounds that includes various opioids. This compound features a bromine atom at the 6-position and a methyl group at the 17-position, contributing to its unique pharmacological properties. The presence of the epoxide functional group at the 4,5-positions indicates potential reactivity, which may influence its biological activity. It is characterized by a complex three-dimensional structure, which is crucial for its interaction with opioid receptors in the body. The compound may exhibit analgesic effects, similar to other morphinan derivatives, but its specific pharmacodynamics and therapeutic applications would depend on further research. As with many synthetic opioids, safety, efficacy, and potential for abuse are important considerations in its study and application.
Formula:C17H18BrNO2
InChI:InChI=1/C17H18BrNO2/c1-19-7-6-17-10-3-4-11(18)16(17)21-15-13(20)5-2-9(14(15)17)8-12(10)19/h2-5,10-12,16,20H,6-8H2,1H3/t10-,11-,12+,16-,17-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Bromo-6-dehydroxy Morphine
CAS:Controlled ProductFormula:C17H18BrNO2Color and Shape:NeatMolecular weight:348.23
