CAS 637338-78-4

3-Chloro-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

3-Chloro-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 3-position of the pyrazole ring and an amino group at the 4-position of the pyrimidine ring, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the amino group suggests potential for hydrogen bonding, influencing its interactions in biological systems. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with various biological targets. Additionally, its unique structure may confer specific properties such as enzyme inhibition or modulation of signaling pathways, making it a candidate for further research in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₅H₄ClN₅

InChI: InChI=1S/C5H4ClN5/c6-3-2-4(7)8-1-9-5(2)11-10-3/h1H,(H3,7,8,9,10,11)

InChI key: InChIKey=QKMIPLXCSQKVBB-UHFFFAOYSA-N

SMILES: NC1=C2C(=NC=N1)NN=C2Cl

Synonyms:

• 3-Chloro-1H-pyrazolo[3,4-d]pyrimidin-4-amine
• 3-Chloro-2H-pyrazolo[3,4-d]pyrimidin-4-amine
• 1H-Pyrazolo[3,4-d]pyrimidin-4-amine, 3-chloro-
• 3-Chloro-5H-pyrazolo[3,4-d]pyrimidin-4-amine