CAS 637347-93-4

2-Amino-5-propylbenzoic acid

Description:

2-Amino-5-propylbenzoic acid, with the CAS number 637347-93-4, is an organic compound characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH) attached to a benzoic acid structure. The propyl group, which is a three-carbon alkyl chain, is located at the 5-position of the benzene ring, contributing to the compound's hydrophobic characteristics. This compound is likely to be a white to off-white solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid and amino functional groups. It may participate in various chemical reactions typical of amino acids, such as forming amides or undergoing decarboxylation. The presence of both amino and carboxylic acid groups suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds. Additionally, its structural features may influence its interaction with biological systems, making it of interest in medicinal chemistry and drug design.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-2-3-7-4-5-9(11)8(6-7)10(12)13/h4-6H,2-3,11H2,1H3,(H,12,13)

InChI key: InChIKey=PCZINJXPGKQTCE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(CCC)=CC=C1N

Synonyms:

• 5-Propylanthranilic acid
• 2-Amino-5-propylbenzoic acid
• Benzoic acid, 2-amino-5-propyl-

2-Amino-5-propylbenzoic acid

CAS: 637347-93-4

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-MAB34793