CymitQuimica logo

CAS 637362-21-1

:

tert-butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate

Description:
Tert-butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both indoline and piperidine moieties. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential solubility in organic solvents. The presence of a chlorine atom at the 5-position of the spiro framework introduces additional reactivity and may influence its biological activity. The spiro structure is notable for its rigidity, which can affect the compound's conformational properties and interactions with biological targets. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological applications, including as intermediates in the synthesis of more complex molecules. The compound's molecular weight, melting point, and specific reactivity would depend on its detailed structural features and functional groups. Overall, tert-butyl 5-chlorospiro[indoline-3,4'-piperidine]-1'-carboxylate represents a class of compounds that may exhibit interesting chemical and biological properties.
Formula:C17H23ClN2O2
InChI:InChI=1/C17H23ClN2O2/c1-16(2,3)22-15(21)20-8-6-17(7-9-20)11-19-14-5-4-12(18)10-13(14)17/h4-5,10,19H,6-9,11H2,1-3H3
InChI key:YONFPBXPHBCLTK-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2(CC1)CNc1ccc(cc21)Cl
Found 4 products.