CAS 6374-78-3
:1-Amino-4,5,8-trihydroxy-9,10-anthracenedione
Description:
1-Amino-4,5,8-trihydroxy-9,10-anthracenedione, also known as anthraquinone derivative, is a chemical compound characterized by its anthraquinone backbone, which consists of three hydroxyl groups and an amino group. This structure contributes to its potential as a dye and pigment, particularly in textile applications. The presence of multiple hydroxyl groups enhances its solubility in polar solvents and can influence its reactivity, making it suitable for various chemical modifications. The amino group can participate in further reactions, allowing for the synthesis of derivatives with tailored properties. This compound exhibits notable biological activity, including potential antimicrobial and antitumor properties, which have garnered interest in medicinal chemistry. Additionally, its stability and color properties make it valuable in the field of organic electronics and photonics. Overall, 1-Amino-4,5,8-trihydroxy-9,10-anthracenedione is a versatile compound with applications spanning from industrial to pharmaceutical fields, driven by its unique chemical characteristics.
Formula:C14H9NO5
InChI:InChI=1/C14H9NO5/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4,16-18H,15H2
InChI key:InChIKey=XOWIUAITUCBCNN-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=C(O)C=CC3O)=C(O)C=CC2N
Synonyms:- 9,10-Anthracenedione, 1-amino-4,5,8-trihydroxy-
- 1-Amino-4,5,8-trihydroxy-9,10-anthracenedione
- 1-amino-4,5,8-trihydroxyanthracene-9,10-dione
- Anthraquinone, 1-amino-4,5,8-trihydroxy-
- 1-Amino-4,5,8-trihydroxyanthraquinone
- Einecs 228-927-8
- Mitoxantrone Impurity 15
- Mitoxantrone Impurity 10
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
