CAS 6374-87-4

2-(chloromethyl)anthraquinone

Description:

2-(Chloromethyl)anthraquinone is an organic compound characterized by its anthraquinone structure, which consists of a three-ring system with two carbonyl groups. This compound features a chloromethyl group (-CH2Cl) attached to the second position of the anthraquinone framework, influencing its reactivity and potential applications. It typically appears as a solid at room temperature and is known for its vibrant color, which is common among anthraquinone derivatives. The presence of the chloromethyl group enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. 2-(Chloromethyl)anthraquinone is often utilized in dye manufacturing, as well as in organic synthesis for producing other functionalized compounds. Additionally, it may exhibit biological activity, which can be explored for potential pharmaceutical applications. However, handling this compound requires caution due to its potential toxicity and environmental impact, necessitating appropriate safety measures in laboratory settings.

Formula: C₁₅H₉ClO₂

InChI: InChI=1/C15H9ClO2/c16-8-9-5-6-12-13(7-9)15(18)11-4-2-1-3-10(11)14(12)17/h1-7H,8H2

SMILES: c1ccc2c(c1)C(=O)c1ccc(cc1C2=O)CCl

Synonyms:

• 2-(Chloromethyl)Anthracene-9,10-Dione

2-(Chloromethyl)anthraquinone

CAS: 6374-87-4

Formula: C₁₅H₉ClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 256.6838

Ref: IN-DA003F0I

2-(Chloromethyl)anthraquinone

CAS: 6374-87-4

2-(Chloromethyl)anthraquinone

Purity: ≥95%

Molecular weight: 256.68g/mol

Ref: 54-OR22730

2-(Chloromethyl)anthraquinone

CAS: 6374-87-4

Purity: 98.0%

Molecular weight: 256.69000244140625

Ref: 10-F493313

2-(Chloromethyl)anthraquinone

CAS: 6374-87-4

2-(Chloromethyl)anthraquinone is an inhibitor of p21, a protein that regulates cell cycle progression. It has been shown to reduce the rate of electron flow in the electron transport chain. 2-(Chloromethyl)anthraquinone has also shown antiradical activity, which may be due to its ability to scavenge anion radicals and hydroxyl radicals or its linker-molecule interactions with other molecules. The molecular target for 2-(chloromethyl)anthraquinone is not known.

Formula: C₁₅H₉ClO₂

Purity: Min. 95%

Molecular weight: 256.68 g/mol

Ref: 3D-FC49813