CymitQuimica logo

CAS 63744-22-9

:

6,8-Dibromoimidazo[1,2-a]pyrazine

Description:
6,8-Dibromoimidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its imidazo and pyrazine ring structures, which contribute to its unique chemical properties. This compound features two bromine atoms substituted at the 6 and 8 positions of the imidazo ring, enhancing its reactivity and potential applications in various fields, including medicinal chemistry and materials science. The presence of bromine atoms can influence the compound's electronic properties, making it a candidate for use in electronic devices or as a building block in the synthesis of more complex molecules. Additionally, the imidazo[1,2-a]pyrazine framework is known for its biological activity, which may include antimicrobial or anticancer properties. The compound is typically synthesized through specific halogenation reactions and may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in practical applications.
Formula:C6H3Br2N3
InChI:InChI=1S/C6H3Br2N3/c7-4-3-11-2-1-9-6(11)5(8)10-4/h1-3H
InChI key:InChIKey=UQCZZGIPIMJBCL-UHFFFAOYSA-N
SMILES:BrC=1C=2N(C=C(Br)N1)C=CN2
Synonyms:
  • 6,8-Dibromimidazo[1,2-a]pyrazin
  • Imidazo[1,2-a]pyrazine, 6,8-dibromo-
  • 6,8-Dibromoimidazo[1,2-a]pyrazine
Found 7 products.