CAS 63744-41-2

5-chloroimidazo[1,2-a]pyrazine

Description:

5-Chloroimidazo[1,2-a]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position of the imidazole ring enhances its reactivity and solubility in various solvents. This compound typically exhibits a pale yellow to off-white crystalline appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its structure allows for various substitution reactions, which can be exploited to modify its properties for specific applications. Additionally, 5-chloroimidazo[1,2-a]pyrazine may exhibit interesting electronic properties due to the conjugation between the aromatic rings, influencing its behavior in chemical reactions and interactions with biological targets. As with many heterocycles, it may also participate in hydrogen bonding and other intermolecular interactions, further expanding its utility in various chemical contexts. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-5-3-8-4-6-9-1-2-10(5)6/h1-4H

SMILES: c1cn2c(cncc2n1)Cl

Synonyms:

• Imidazo[1,2-A]Pyrazine, 5-Chloro-

5-Chloroimidazo[1,2-a]pyrazine

CAS: 63744-41-2

Formula: C₆H₄ClN₃

Purity: 90%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA00EDAZ

5-Chloroimidazo[1,2-a]pyrazine

CAS: 63744-41-2

5-Chloroimidazo[1,2-a]pyrazine

Purity: 96%

Molecular weight: 153.57g/mol

Ref: 54-OR951845

5-Chloroimidazo[1,2-a]pyrazine

CAS: 63744-41-2

Formula: C₆H₄ClN₃

Purity: 90%

Color and Shape: Solid

Molecular weight: 153.57

Ref: 10-F218890

5-Chloroimidazo[1,2-a]pyrazine

CAS: 63744-41-2

Purity: 90%

Molecular weight: 153.569

Ref: FT-C12877