CAS 6376-14-3
:4-Chloro-2-methoxy-5-methylaniline
Description:
4-Chloro-2-methoxy-5-methylaniline, with the CAS number 6376-14-3, is an organic compound that belongs to the class of anilines, which are aromatic amines. This substance features a chloro group, a methoxy group, and a methyl group attached to a benzene ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a pale yellow to brown color. The presence of the chloro and methoxy substituents influences its reactivity and solubility, making it more polar compared to unsubstituted anilines. This compound is often used in organic synthesis and may serve as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Its chemical structure allows for various reactions, including electrophilic aromatic substitution and nucleophilic substitution, depending on the conditions. Safety data indicates that, like many anilines, it should be handled with care due to potential toxicity and environmental impact. Proper safety measures should be observed when working with this compound in laboratory settings.
Formula:C8H10ClNO
InChI:InChI=1S/C8H10ClNO/c1-5-3-7(10)8(11-2)4-6(5)9/h3-4H,10H2,1-2H3
InChI key:InChIKey=XBAPOWUMJRIKAV-UHFFFAOYSA-N
SMILES:O(C)C1=C(N)C=C(C)C(Cl)=C1
Synonyms:- (4-Chloro-2-methoxy-5-methylphenyl)amine
- 2-Methoxy-4-chloro-5-methylaniline
- 228-943-5
- 4-Chloro-2-Methoxy-5-Methylaniline
- 4-Chloro-2-methoxy-5-methylbenzenamine
- Benzenamine, 4-Chloro-2-Methoxy-5-Methyl-
- o-Anisidine, 4-chloro-5-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Chloro-2-methoxy-5-methylaniline
CAS:Formula:C8H10ClNOPurity:97%Color and Shape:SolidMolecular weight:171.62414-Chloro-2-methoxy-5-methylaniline
CAS:4-Chloro-2-methoxy-5-methylanilineFormula:C8H10ClNOPurity:97%Color and Shape: tan solidMolecular weight:171.62g/mol4-Chloro-2-methoxy-5-methylaniline
CAS:4-Chloro-2-methoxy-5-methylaniline is a dye molecule that is used in the synthesis of other molecules, such as diketene. It is also used as a solvent, coupling agent, and a dye molecule. This compound can be synthetically prepared by reacting naphthylamine with pyrazolone. The reaction requires catalytic amounts of polyvalent metal salts, such as zinc chloride or iron(III) chloride. The halogenation of 4-chloro-2-methoxy-5-methylaniline to produce 2,4,5-trichlorophenol can be achieved by diazotising the molecule with sodium nitrite and potassium dichromate. 4-Chloro-2-methoxy-5 methylaniline's substituents are methyl groups on the phenyl ring (Cl) and chlorine atoms (C1). Derivatives of thisFormula:C8H10ClNOPurity:Min. 95%Molecular weight:171.62 g/mol


