CAS 6376-26-7
:Salverine
Description:
Salverine, with the CAS number 6376-26-7, is a chemical compound that belongs to the class of tropane alkaloids. It is primarily recognized for its potential pharmacological properties, particularly as an antispasmodic agent. Salverine exhibits a structure that allows it to interact with various receptors in the body, which may contribute to its therapeutic effects. The compound is typically characterized by its ability to relax smooth muscle tissue, making it useful in treating conditions associated with spasms in the gastrointestinal tract. Additionally, salverine may have implications in research related to neurological functions due to its interaction with neurotransmitter systems. Its solubility and stability can vary depending on the formulation and environmental conditions, which are important factors to consider in both laboratory and clinical settings. As with many chemical substances, safety and handling precautions are essential, given its biological activity. Further studies are often conducted to fully understand its mechanisms of action and potential applications in medicine.
Formula:C19H24N2O2
InChI:InChI=1S/C19H24N2O2/c1-3-21(4-2)14-15-23-18-13-9-8-12-17(18)19(22)20-16-10-6-5-7-11-16/h5-13H,3-4,14-15H2,1-2H3,(H,20,22)
InChI key:InChIKey=BOFYHBVFGWJLIZ-UHFFFAOYSA-N
SMILES:O(CCN(CC)CC)C1=C(C(NC2=CC=CC=C2)=O)C=CC=C1
Synonyms:- Benzamide, 2-[2-(diethylamino)ethoxy]-N-phenyl-
- 2-[2-(Diethylamino)ethoxy]-N-phenylbenzamide
- Salverine
- Benzanilide, 2-[2-(diethylamino)ethoxy]-
- M 811
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
