CAS 63762-72-1

6-chloro-5-methoxy-1H-indole

Description:

6-Chloro-5-methoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 6-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic indole core. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, owing to the electron-rich nature of the indole ring. Additionally, the chlorine substituent can influence the compound's reactivity and biological activity, potentially making it of interest in medicinal chemistry and drug development. The methoxy group can also affect the compound's electronic properties and steric hindrance. Overall, 6-chloro-5-methoxy-1H-indole is a compound of interest in various fields, including pharmaceuticals and organic synthesis, due to its structural features and potential applications.

Formula: C₉H₈ClNO

InChI: InChI=1/C9H8ClNO/c1-12-9-4-6-2-3-11-8(6)5-7(9)10/h2-5,11H,1H3

SMILES: COc1cc2cc[nH]c2cc1Cl

Synonyms:

• 1H-indole, 6-chloro-5-methoxy-
• 6-Chloro-5-methoxy-1H-indole

1H-Indole, 6-chloro-5-Methoxy-

CAS: 63762-72-1

Formula: C₉H₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.6189

Ref: IN-DA00EFVD

6-chloro-5-methoxy-1H-indole

CAS: 63762-72-1

6-chloro-5-methoxy-1H-indole

Purity: 98%

Molecular weight: 181.62g/mol

Ref: 54-OR84750

6-Chloro-5-methoxy-1H-indole

CAS: 63762-72-1

Formula: C₉H₈ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 181.62

Ref: 10-F329401

6-chloro-5-methoxy-1H-indole

CAS: 63762-72-1

6-chloro-5-methoxy-1H-indole is an aromatic compound that can be synthesized by the amination of acetyl chloride. This reaction is followed by a borohydride reduction of the imine, and then an acetylation of the resulting alcohol. The synthesis method involves two steps: first, a borohydride reduction of the imine using sodium borohydride; and second, an acetylation with chloral. The final product is purified by distillation and elemental analysis to determine yields.

Formula: C₉H₈NOCl

Purity: Min. 95%

Molecular weight: 181.61 g/mol

Ref: 3D-NCA76272