CAS 63763-05-3

4-(Cyclopentyloxy)benzoyl chloride

Description:

4-(Cyclopentyloxy)benzoyl chloride, with the CAS number 63763-05-3, is an organic compound characterized by the presence of a benzoyl chloride functional group attached to a cyclopentyloxy substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the acyl chloride functional group, which can readily undergo nucleophilic substitution reactions, making it useful in organic synthesis, particularly in the formation of esters and amides. The cyclopentyloxy group contributes to its unique properties, potentially influencing solubility and reactivity. As with many acyl chlorides, it is likely to be sensitive to moisture and can release hydrochloric acid upon hydrolysis. Safety precautions should be taken when handling this compound, as it may be corrosive and irritant to skin and mucous membranes. Proper storage in a cool, dry place, away from moisture and incompatible substances, is essential to maintain its stability and reactivity.

Formula: C₁₂H₁₃ClO₂

InChI: InChI=1S/C12H13ClO2/c13-12(14)9-5-7-11(8-6-9)15-10-3-1-2-4-10/h5-8,10H,1-4H2

InChI key: InChIKey=UNERQANHKKJITO-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(Cl)=O)C=C1)C2CCCC2

Synonyms:

• Benzoyl chloride, 4-(cyclopentyloxy)-
• 4-(Cyclopentyloxy)benzoyl chloride