CAS 63766-56-3

1-oxa-7-azaspiro[4.5]decane

Description:

1-Oxa-7-azaspiro[4.5]decane is a bicyclic compound characterized by its unique spiro structure, which consists of a nitrogen atom and an oxygen atom incorporated into its framework. The compound features a spirocyclic arrangement, where two rings share a single atom, contributing to its distinctive three-dimensional shape. This structure can influence its chemical reactivity and biological activity. Typically, compounds like 1-oxa-7-azaspiro[4.5]decane may exhibit properties such as moderate polarity due to the presence of heteroatoms (nitrogen and oxygen), which can engage in hydrogen bonding. The presence of these functional groups often enhances solubility in polar solvents. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its unique structural characteristics may also allow for interactions with biological targets, making it a subject of interest in drug design and synthesis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₈H₁₅NO

InChI: InChI=1/C8H15NO/c1-3-8(7-9-5-1)4-2-6-10-8/h9H,1-7H2

SMILES: C1CC2(CCCO2)CNC1

Synonyms:

• 1-Oxa-7-azaspiro[4.5]decan

1-Oxa-7-Azaspiro[4.5]Decane

CAS: 63766-56-3

Formula: C₈H₁₅NO

Color and Shape: Liquid

Molecular weight: 141.2108

Ref: IN-DA00ECBR

1-Oxa-7-azaspiro[4.5]decane

CAS: 63766-56-3

Oxa-7-azaspiro[4.5]decane is a compound that is structurally related to the neurotransmitter substance P and has been shown to be a potent, selective antagonist of neurokinin (NK) receptors. Oxa-7-azaspiro[4.5]decane inhibits the release of dopamine from rat brain synaptosomes and depresses synapses in the rat hippocampus, an effect that can be reversed by administration of an NK receptor antagonist. This drug also has anti-cancer activity against chemotherapy-induced depression in rats and has been shown to inhibit proliferation in rat hepatocytes. The oxygen atom on the molecule is responsible for its oxidative properties, which are due to its ability to form reactive oxygen species such as superoxide and hydroxyl radicals when it reacts with water or hydrogen peroxide. These reactive oxygen species are able to damage DNA, RNA, enzymes, or other molecules by oxidation.

Formula: C₈H₁₅NO

Purity: Min. 95%

Molecular weight: 141.21 g/mol

Ref: 3D-NCA76656