CAS 63775-95-1
:Cyclosporin B
Description:
Cyclosporin B is a cyclic polypeptide and a member of the cyclosporin family, primarily known for its immunosuppressive properties. It is produced by the fungus Tolypocladium inflatum and is structurally similar to cyclosporin A, differing by a single amino acid. Cyclosporin B exhibits a unique mechanism of action by inhibiting T-cell activation and proliferation, making it valuable in organ transplantation and autoimmune disease management. The substance is lipophilic, which influences its solubility and absorption characteristics. It is typically administered via oral or intravenous routes and is metabolized primarily by the liver, with a significant interaction profile with various drugs due to its effects on cytochrome P450 enzymes. While cyclosporin B has therapeutic potential, it also carries risks of nephrotoxicity and other side effects, necessitating careful monitoring during treatment. Its use is less common than cyclosporin A, but ongoing research continues to explore its applications in clinical settings.
Formula:C61H109N11O12
InChI:InChI=1/C61H109N11O12/c1-25-26-27-39(14)51(74)50-55(78)64-41(16)56(79)66(18)32-47(73)67(19)43(28-33(2)3)54(77)65-48(37(10)11)60(83)68(20)44(29-34(4)5)53(76)62-40(15)52(75)63-42(17)57(80)69(21)45(30-35(6)7)58(81)70(22)46(31-36(8)9)59(82)71(23)49(38(12)13)61(84)72(50)24/h25-26,33-46,48-51,74H,27-32H2,1-24H3,(H,62,76)(H,63,75)(H,64,78)(H,65,77)/b26-25+/t39?,40-,41+,42+,43+,44+,45+,46+,48+,49+,50-,51?/m1/s1
Synonyms:- Cyclo[L-alanyl-D-alanyl-N-methyl-L-leucyl-N-methyl-L-leucyl-N-methyl-L-valyl-3-hydroxy-N,4-dimethyl-L-2-amino-6-octenoyl-L-alanyl-N-methylglycyl-N-methyl-L-leucyl-L-valyl-N-methyl-L-leucyl]
- (3S,6S,9S,12S,15R,18S,21S,24S,30S,33R)-33-[(E)-1-hydroxy-2-methyl-hex-4-enyl]-6,9,18,24-tetraisobutyl-3,21-diisopropyl-1,4,7,10,12,15,19,25,28,30-decamethyl-1,4,7,10,13,16,19,22,25,28,31-undecazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
- Cyclosporin B, >=95%
- Antibiotic S 7481F2
- Cyclosporin B (9CI)
- (3R,4R)-3-Hydroxy-N-methyl-5-[(E)-1-propenyl]cyclo(L-Leu-L-Ala-Sar-N-methyl-L-Leu-L-Val-N-methyl-L-Leu-L-Ala-D-Ala-N-methyl-L-Leu-N-methyl-L-Leu-N-methyl-L-Val-)
- 7-L-Alaninecyclosporine A
- Ala2-cyclosporine
- Cyclosporine IMpurity-B
- CYCLOSPORIN B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclosporin B
CAS:<p>Applications An immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection.A group of nonpolar cyclic oligopeptides with immunosupppressant activity.<br>References van Wartburg, A., et al.: Prog. Med. Chem., 25, 1 (1988), Jorgensen, K.A., et al.: Scand. J. Imunol., 57, 93 (2003), Vollenbroeker, et al.: Transplant. Proc., 37, 1741 (2005),<br></p>Formula:C61H109N11O12Purity:>80%Color and Shape:NeatMolecular weight:1188.58Cyclosporin B
CAS:<p>Cyclosporin B is an antifungal and immunosuppressive cyclic peptide, which is derived from the fungus *Tolypocladium inflatum*. The compound is a member of the cyclosporin family, characterized by cyclic polypeptides with a unique arrangement of amino acids that enable its biological activity. Though its precise mode of action is not completely delineated, it is observed to influence cell growth and viability by potentially disrupting cellular communication or signal transduction pathways.</p>Formula:C61H109N11O12Purity:Min. 95%Color and Shape:PowderMolecular weight:1,188.59 g/mol





