CAS 63779-86-2
:6-chloro-4-nitroso-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide
Description:
6-Chloro-4-nitroso-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide is a chemical compound characterized by its complex structure, which includes a benzothiadiazine core. This compound features a chloro group and a nitroso group, contributing to its reactivity and potential biological activity. The sulfonamide moiety is significant for its applications in medicinal chemistry, particularly in the development of antibacterial agents. The presence of the 1,1-dioxide indicates that it has two oxygen atoms double-bonded to the sulfur atom, enhancing its solubility and stability in various solvents. The compound's unique functional groups suggest potential interactions with biological targets, making it of interest in pharmacological research. Its CAS number, 63779-86-2, allows for easy identification in chemical databases, facilitating further studies on its properties, synthesis, and applications. Overall, this compound exemplifies the diverse chemistry of sulfonamides and their derivatives in drug development.
Formula:C7H7ClN4O5S2
InChI:InChI=1/C7H7ClN4O5S2/c8-4-1-5-7(2-6(4)18(9,14)15)19(16,17)10-3-12(5)11-13/h1-2,10H,3H2,(H2,9,14,15)
SMILES:c1c(c(cc2c1N(CNS2(=O)=O)N=O)S(=O)(=O)N)Cl
Synonyms:- 2H-1,2,4-Benzothiadiazine-7-sulfonamide,6-chloro-3,4-dihydro-4-nitroso-, 1,1-dioxide
- 4-Nitroso-hct
- Hydrochlorothiazide
- Hydrochlorothiazide Impurity 23
- N-Nitroso
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
N-Nitroso Hydrochlorothiazide
CAS:Formula:C7H7ClN4O5S2Purity:98%Color and Shape:SolidMolecular weight:326.7373N4-Nitroso Hydrochlorothiazide
CAS:Formula:C7H7ClN4O5S2Color and Shape:Off-White SolidMolecular weight:326.73N4-Nitroso Hydrochlorothiazide-13C-15N2-d2
CAS:Formula:C613CH5D2ClN215N2O5S2Color and Shape:Off-White SolidMolecular weight:331.72N-Nitroso Hydrochlorothiazide
CAS:Formula:C7H7ClN4O5S2Color and Shape:Off-WhiteMolecular weight:326.737N-Nitroso hydrochlorothiazide
CAS:<p>Please enquire for more information about N-Nitroso hydrochlorothiazide including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C7H7ClN4O5S2Purity:Min. 95%Molecular weight:326.74 g/molN-Nitroso Hydrochlorothiazide Solution (1 mL )
CAS:Sulfonamides, nesoiFormula:C7H7ClN4O5S2Molecular weight:325.95464







