CAS 6378-19-4
:4-(Chloromethyl)-1-methoxy-2-nitrobenzene
Description:
4-(Chloromethyl)-1-methoxy-2-nitrobenzene, with the CAS number 6378-19-4, is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloromethyl substituent. This compound features a methoxy group (-OCH3) attached to the benzene ring, contributing to its reactivity and solubility properties. The presence of the nitro group (-NO2) typically enhances the electrophilic character of the aromatic ring, making it more susceptible to further chemical reactions, such as nucleophilic substitutions. The chloromethyl group (-CH2Cl) serves as a versatile functional group, allowing for various transformations in synthetic organic chemistry. This compound is often utilized in research and industrial applications, particularly in the synthesis of pharmaceuticals and agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety precautions should be observed when handling this compound, as it may pose health risks due to its chlorinated and nitro functionalities.
Formula:C8H8ClNO3
InChI:InChI=1/C8H8ClNO3/c1-13-8-3-2-6(5-9)4-7(8)10(11)12/h2-4H,5H2,1H3
InChI key:InChIKey=DKRYRFRNGLTDMB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(OC)C=CC(CCl)=C1
Synonyms:- 3-Nitro-4-methoxybenzyl chloride
- 4-(Chloromethyl)-1-(methyloxy)-2-nitrobenzene
- 4-(Chloromethyl)-1-Methoxy-2-Nitrobenzene
- 4-Methoxy-3-nitrobenzyl chloride
- Anisole, 4-(chloromethyl)-2-nitro-
- Benzene, 4-(chloromethyl)-1-methoxy-2-nitro-
- NSC 19935
- 4-(Chloromethyl)-2-nitroanisole
- Nsc19935
- tetrasodium 2-[[7-[[bis(carboxylatomethyl)amino]methyl]-9-(2-carboxyphenyl)-3-hydroxy-6-oxo-2-xanthenyl]methyl-(carboxylatomethyl)amino]acetate
- 1-Chloromethyl-4-methoxy-3-nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(Chloromethyl)-1-methoxy-2-nitrobenzene
CAS:Formula:C8H8ClNO3Color and Shape:SolidMolecular weight:201.60704-(Chloromethyl)-1-methoxy-2-nitrobenzene
CAS:<p>4-(Chloromethyl)-1-methoxy-2-nitrobenzene is a heterocyclic compound that belongs to the group of germicides. It is prepared by the reaction of potassium carbonate with methylamine and 4-chloro-1-methoxybenzene. The chloromethyl group in this compound can be replaced by other halogens, such as bromine or iodine, in order to produce other derivatives. This type of chemical has been used in the past as a fungicide, but is now mostly used as a precursor for dyes. 4-(Chloromethyl)-1-methoxy-2-nitrobenzene has an analogous reaction with amines, which are compounds containing nitrogen and hydrogen atoms that have one or more organic substituents. These reactions are useful for producing drugs such as amphetamines, barbiturates, and some types of antibiotics.</p>Formula:C8H8ClNO3Purity:Min. 95%Molecular weight:201.61 g/mol

