CAS 638-13-1
:2(1H)-Pyrimidinone, 3,4-dihydro-6-methyl-4-thioxo-
Description:
2(1H)-Pyrimidinone, 3,4-dihydro-6-methyl-4-thioxo- (CAS 638-13-1) is a heterocyclic organic compound characterized by a pyrimidine ring structure that features a thioxo group and a methyl substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The presence of the thioxo group contributes to its reactivity, particularly in nucleophilic addition reactions. It may also participate in tautomeric equilibria due to the keto-enol forms associated with the pyrimidinone structure. The compound is of interest in medicinal chemistry and may exhibit biological activity, making it a subject of research in drug development. Its molecular structure allows for various functional group modifications, which can influence its pharmacological properties. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C5H6N2OS
InChI:InChI=1/C5H6N2OS/c1-3-2-4(9)7-5(8)6-3/h2H,1H3,(H2,6,7,8,9)
SMILES:Cc1cc(nc(n1)O)S
Synonyms:- 4-Methyl-6-mercapto-2-pyrimidinol
- 6-methyl-4-thioxo-3,4-dihydropyrimidin-2(1H)-one
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery